C14H16N2O3 — CID 110835922
3-[(2,5-dimethyl-1H-indole-3-carbonyl)amino]propanoic acid (PubChem CID 110835922) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[(2,5-dimethyl-1H-indole-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(2,5-dimethyl-1H-indole-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110835922 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-[(2,5-dimethyl-1H-indole-3-carbonyl)amino]propanoic acid |
| SMILES | Cc1ccc2[nH]c(C)c(C(=O)NCCC(=O)O)c2c1 |
| InChI | InChI=1S/C14H16N2O3/c1-8-3-4-11-10(7-8)13(9(2)16-11)14(19)15-6-5-12(17)18/h3-4,7,16H,5-6H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | SIFMWICMRICNHQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |