C18H17FN2O2 — CID 110614865
5-fluoro-N-[2-(2-hydroxyphenyl)ethyl]-2-methyl-1H-indole-3-carboxamide (PubChem CID 110614865) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 5-fluoro-N-[2-(2-hydroxyphenyl)ethyl]-2-methyl-1H-indole-3-carboxamide.
| Compound Name | 5-fluoro-N-[2-(2-hydroxyphenyl)ethyl]-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 110614865 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 5-fluoro-N-[2-(2-hydroxyphenyl)ethyl]-2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1C(=O)NCCc1ccccc1O |
| InChI | InChI=1S/C18H17FN2O2/c1-11-17(14-10-13(19)6-7-15(14)21-11)18(23)20-9-8-12-4-2-3-5-16(12)22/h2-7,10,21-22H,8-9H2,1H3,(H,20,23) |
| InChIKey | JAUXKHGXMUNAOY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |