C18H22FN3O2 — CID 110625213
N-[2-(cyclohexylamino)-2-oxoethyl]-5-fluoro-2-methyl-1H-indole-3-carboxamide (PubChem CID 110625213) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxoethyl]-5-fluoro-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxoethyl]-5-fluoro-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 110625213 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxoethyl]-5-fluoro-2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1C(=O)NCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H22FN3O2/c1-11-17(14-9-12(19)7-8-15(14)21-11)18(24)20-10-16(23)22-13-5-3-2-4-6-13/h7-9,13,21H,2-6,10H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | YVVMBPACNUTALV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |