C23H26FN3O — CID 13490832
5-fluoro-2-methyl-N-[1-(1-phenylethyl)piperidin-4-yl]-1H-indole-3-carboxamide (PubChem CID 13490832) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is 5-fluoro-2-methyl-N-[1-(1-phenylethyl)piperidin-4-yl]-1H-indole-3-carboxamide.
| Compound Name | 5-fluoro-2-methyl-N-[1-(1-phenylethyl)piperidin-4-yl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 13490832 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 5-fluoro-2-methyl-N-[1-(1-phenylethyl)piperidin-4-yl]-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1C(=O)NC1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26FN3O/c1-15-22(20-14-18(24)8-9-21(20)25-15)23(28)26-19-10-12-27(13-11-19)16(2)17-6-4-3-5-7-17/h3-9,14,16,19,25H,10-13H2,1-2H3,(H,26,28) |
| InChIKey | NJCVCLMRMJLWTG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |