C12H24N2O2 — CID 110838532
4-methyl-2-[methyl-(1-methylpyrrolidin-3-yl)amino]pentanoic acid (PubChem CID 110838532) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-methyl-2-[methyl-(1-methylpyrrolidin-3-yl)amino]pentanoic acid.
| Compound Name | 4-methyl-2-[methyl-(1-methylpyrrolidin-3-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 110838532 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-methyl-2-[methyl-(1-methylpyrrolidin-3-yl)amino]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N(C)C1CCN(C)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-9(2)7-11(12(15)16)14(4)10-5-6-13(3)8-10/h9-11H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | ARLWXVCVPZKIEB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |