C9H20N2 — CID 129222465
(3R)-N,1-dimethyl-N-propan-2-ylpyrrolidin-3-amine (PubChem CID 129222465) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is (3R)-N,1-dimethyl-N-propan-2-ylpyrrolidin-3-amine.
| Compound Name | (3R)-N,1-dimethyl-N-propan-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 129222465 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (3R)-N,1-dimethyl-N-propan-2-ylpyrrolidin-3-amine |
| SMILES | CC(C)N(C)[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C9H20N2/c1-8(2)11(4)9-5-6-10(3)7-9/h8-9H,5-7H2,1-4H3/t9-/m1/s1 |
| InChIKey | PZOWGIAHGMYOCO-SECBINFHSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |