C7H16N2 — CID 59975379
(3S)-N,N,1-trimethylpyrrolidin-3-amine (PubChem CID 59975379) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (3S)-N,N,1-trimethylpyrrolidin-3-amine.
| Compound Name | (3S)-N,N,1-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 59975379 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (3S)-N,N,1-trimethylpyrrolidin-3-amine |
| SMILES | CN1CC[C@H](N(C)C)C1 |
| InChI | InChI=1S/C7H16N2/c1-8(2)7-4-5-9(3)6-7/h7H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | IWNBQXFSYAIRCJ-ZETCQYMHSA-N |
| XLogP | 0.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |