About 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine
1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine (PubChem CID 139373352) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol. Its IUPAC name is 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine |
| PubChem CID | 139373352 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine |
| SMILES | CNN1CCC(N(C)C)C1 |
| InChI | InChI=1S/C7H17N3/c1-8-10-5-4-7(6-10)9(2)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | CRCZOBRVAZRLIC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine?
The IUPAC name of 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine (CID 139373352) is 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine.
What is the SMILES notation for 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine?
The canonical SMILES for 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine is CNN1CCC(N(C)C)C1.
What is the InChIKey of 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine?
The InChIKey is CRCZOBRVAZRLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-8-10-5-4-7(6-10)9(2)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine?
1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine has a molecular weight of 143.23 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine is sourced from PubChem (CID 139373352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).