C7H17N3 — CID 139373352
1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine (PubChem CID 139373352) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine.
| Compound Name | 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine |
|---|---|
| PubChem CID | 139373352 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1-N,3-N,3-N-trimethylpyrrolidine-1,3-diamine |
| SMILES | CNN1CCC(N(C)C)C1 |
| InChI | InChI=1S/C7H17N3/c1-8-10-5-4-7(6-10)9(2)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | CRCZOBRVAZRLIC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |