C10H21N3 — CID 57226950
N,N-dimethyl-1-pyrrolidin-1-ylpyrrolidin-3-amine (PubChem CID 57226950) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N,N-dimethyl-1-pyrrolidin-1-ylpyrrolidin-3-amine.
| Compound Name | N,N-dimethyl-1-pyrrolidin-1-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 57226950 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N,N-dimethyl-1-pyrrolidin-1-ylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(N2CCCC2)C1 |
| InChI | InChI=1S/C10H21N3/c1-11(2)10-5-8-13(9-10)12-6-3-4-7-12/h10H,3-9H2,1-2H3 |
| InChIKey | SBKPEGVTHPRBDP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |