C6H14N2S2 — CID 153223545
1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 153223545) has the molecular formula C6H14N2S2 and a molecular weight of 178.33 g/mol. Its IUPAC name is 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 153223545 |
| Molecular Formula | C6H14N2S2 |
| Molecular Weight | 178.33 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(SS)C1 |
| InChI | InChI=1S/C6H14N2S2/c1-7(2)6-3-4-8(5-6)10-9/h6,9H,3-5H2,1-2H3 |
| InChIKey | WODMFPRCRYTOEU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|