About 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine
1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 153223545) has the molecular formula C6H14N2S2
and a molecular weight of 178.33 g/mol. Its IUPAC name is 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine |
| PubChem CID | 153223545 |
| Molecular Formula | C6H14N2S2 |
| Molecular Weight | 178.33 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(SS)C1 |
| InChI | InChI=1S/C6H14N2S2/c1-7(2)6-3-4-8(5-6)10-9/h6,9H,3-5H2,1-2H3 |
| InChIKey | WODMFPRCRYTOEU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine?
The IUPAC name of 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine (CID 153223545) is 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine.
What is the SMILES notation for 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine?
The canonical SMILES for 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine is CN(C)C1CCN(SS)C1.
What is the InChIKey of 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine?
The InChIKey is WODMFPRCRYTOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2S2/c1-7(2)6-3-4-8(5-6)10-9/h6,9H,3-5H2,1-2H3.
What are the key properties of 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine?
1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine has a molecular weight of 178.33 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)-N,N-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 153223545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).