C7H15BrN2 — CID 115261820
N-(bromomethyl)-N,1-dimethylpyrrolidin-3-amine (PubChem CID 115261820) has the molecular formula C7H15BrN2 and a molecular weight of 207.11 g/mol. Its IUPAC name is N-(bromomethyl)-N,1-dimethylpyrrolidin-3-amine.
| Compound Name | N-(bromomethyl)-N,1-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115261820 |
| Molecular Formula | C7H15BrN2 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | N-(bromomethyl)-N,1-dimethylpyrrolidin-3-amine |
| SMILES | CN1CCC(N(C)CBr)C1 |
| InChI | InChI=1S/C7H15BrN2/c1-9-4-3-7(5-9)10(2)6-8/h7H,3-6H2,1-2H3 |
| InChIKey | NCVAXBREIWWDAN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|