C7H15N2- — CID 21039801
N-methanidyl-N,1-dimethylpyrrolidin-3-amine (PubChem CID 21039801) has the molecular formula C7H15N2- and a molecular weight of 127.21 g/mol. Its IUPAC name is N-methanidyl-N,1-dimethylpyrrolidin-3-amine.
| Compound Name | N-methanidyl-N,1-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 21039801 |
| Molecular Formula | C7H15N2- |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | N-methanidyl-N,1-dimethylpyrrolidin-3-amine |
| SMILES | [CH2-]N(C)C1CCN(C)C1 |
| InChI | InChI=1S/C7H15N2/c1-8(2)7-4-5-9(3)6-7/h7H,1,4-6H2,2-3H3/q-1 |
| InChIKey | AAJKTLQQJFLNNT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|