C7H15IN2 — CID 134413074
N-iodo-N,1-dimethylpiperidin-4-amine (PubChem CID 134413074) has the molecular formula C7H15IN2 and a molecular weight of 254.11 g/mol. Its IUPAC name is N-iodo-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-iodo-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 134413074 |
| Molecular Formula | C7H15IN2 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | N-iodo-N,1-dimethylpiperidin-4-amine |
| SMILES | CN1CCC(N(C)I)CC1 |
| InChI | InChI=1S/C7H15IN2/c1-9-5-3-7(4-6-9)10(2)8/h7H,3-6H2,1-2H3 |
| InChIKey | JCYVZYRJMHSEHE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|