C13H30N2 — CID 142525400
2-methylbutane;N,N,1-trimethylpiperidin-4-amine (PubChem CID 142525400) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-methylbutane;N,N,1-trimethylpiperidin-4-amine.
| Compound Name | 2-methylbutane;N,N,1-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 142525400 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2-methylbutane;N,N,1-trimethylpiperidin-4-amine |
| SMILES | CCC(C)C.CN1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C8H18N2.C5H12/c1-9(2)8-4-6-10(3)7-5-8;1-4-5(2)3/h8H,4-7H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | BHIGJNZNMOFPOT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |