C11H24N2 — CID 90697678
1-butan-2-yl-N,N-dimethylpiperidin-4-amine (PubChem CID 90697678) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-butan-2-yl-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-butan-2-yl-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 90697678 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-butan-2-yl-N,N-dimethylpiperidin-4-amine |
| SMILES | CCC(C)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C11H24N2/c1-5-10(2)13-8-6-11(7-9-13)12(3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | ROVXNHXETZMNNW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |