C7H15N2O2S- — CID 67051302
1-methyl-4-[methyl(sulfinato)amino]piperidine (PubChem CID 67051302) has the molecular formula C7H15N2O2S- and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-methyl-4-[methyl(sulfinato)amino]piperidine.
| Compound Name | 1-methyl-4-[methyl(sulfinato)amino]piperidine |
|---|---|
| PubChem CID | 67051302 |
| Molecular Formula | C7H15N2O2S- |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1-methyl-4-[methyl(sulfinato)amino]piperidine |
| SMILES | CN1CCC(N(C)S(=O)[O-])CC1 |
| InChI | InChI=1S/C7H16N2O2S/c1-8-5-3-7(4-6-8)9(2)12(10)11/h7H,3-6H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | QRCMMAHUHZEVHE-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|