C10H19BrN2 — CID 130650445
N-(2-bromoprop-2-enyl)-N,1-dimethylpiperidin-3-amine (PubChem CID 130650445) has the molecular formula C10H19BrN2 and a molecular weight of 247.18 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N,1-dimethylpiperidin-3-amine.
| Compound Name | N-(2-bromoprop-2-enyl)-N,1-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 130650445 |
| Molecular Formula | C10H19BrN2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N,1-dimethylpiperidin-3-amine |
| SMILES | C=C(Br)CN(C)C1CCCN(C)C1 |
| InChI | InChI=1S/C10H19BrN2/c1-9(11)7-13(3)10-5-4-6-12(2)8-10/h10H,1,4-8H2,2-3H3 |
| InChIKey | LGKQLFSECYVDLB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |