C9H20N2O — CID 115258466
N-(methoxymethyl)-N,1-dimethylpiperidin-3-amine (PubChem CID 115258466) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N-(methoxymethyl)-N,1-dimethylpiperidin-3-amine.
| Compound Name | N-(methoxymethyl)-N,1-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 115258466 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N-(methoxymethyl)-N,1-dimethylpiperidin-3-amine |
| SMILES | COCN(C)C1CCCN(C)C1 |
| InChI | InChI=1S/C9H20N2O/c1-10-6-4-5-9(7-10)11(2)8-12-3/h9H,4-8H2,1-3H3 |
| InChIKey | SISNCRLWLXQEFP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|