C22H21ClN2O — CID 110840727
4-chloro-N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]aniline (PubChem CID 110840727) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is 4-chloro-N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]aniline.
| Compound Name | 4-chloro-N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110840727 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-chloro-N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]aniline |
| SMILES | Cc1ccc(C)c(COc2ccc(C=NNc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C22H21ClN2O/c1-16-3-4-17(2)19(13-16)15-26-22-11-5-18(6-12-22)14-24-25-21-9-7-20(23)8-10-21/h3-14,25H,15H2,1-2H3 |
| InChIKey | NVVRDQOQGHVTEC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|