C23H24N2O — CID 110840934
N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]-4-methylaniline (PubChem CID 110840934) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]-4-methylaniline.
| Compound Name | N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 110840934 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[[4-[(2,5-dimethylphenyl)methoxy]phenyl]methylideneamino]-4-methylaniline |
| SMILES | Cc1ccc(NN=Cc2ccc(OCc3cc(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-17-5-10-22(11-6-17)25-24-15-20-8-12-23(13-9-20)26-16-21-14-18(2)4-7-19(21)3/h4-15,25H,16H2,1-3H3 |
| InChIKey | XHKSEFQWISAJGG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|