C17H18O2 — CID 91241633
2-[4-[(2,5-dimethylphenyl)methoxy]phenyl]acetaldehyde (PubChem CID 91241633) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethylphenyl)methoxy]phenyl]acetaldehyde.
| Compound Name | 2-[4-[(2,5-dimethylphenyl)methoxy]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 91241633 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[4-[(2,5-dimethylphenyl)methoxy]phenyl]acetaldehyde |
| SMILES | Cc1ccc(C)c(COc2ccc(CC=O)cc2)c1 |
| InChI | InChI=1S/C17H18O2/c1-13-3-4-14(2)16(11-13)12-19-17-7-5-15(6-8-17)9-10-18/h3-8,10-11H,9,12H2,1-2H3 |
| InChIKey | VSDOVTGQMDXJOF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|