[4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid

C15H17BO3 — CID 61481951

IUPAC[4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid
SMILESCc1ccc(C)c(COc2ccc(B(O)O)cc2)c1
InChIInChI=1S/C15H17BO3/c1-11-3-4-12(2)13(9-11)10-19-15-7-5-14(6-8-15)16(17)18/h3-9,17-18H,10H2,1-2H3
InChIKeyIHVBLOIBCABJAS-UHFFFAOYSA-N
MW256.11 g/mol
LogP1.56
Rot. Bonds4

About [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid

[4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid (PubChem CID 61481951) has the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. Its IUPAC name is [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid.

Molecular Properties

Compound Name[4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid
PubChem CID61481951
Molecular FormulaC15H17BO3
Molecular Weight256.11 g/mol
Exact Mass256.13
IUPAC Name[4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid
SMILESCc1ccc(C)c(COc2ccc(B(O)O)cc2)c1
InChIInChI=1S/C15H17BO3/c1-11-3-4-12(2)13(9-11)10-19-15-7-5-14(6-8-15)16(17)18/h3-9,17-18H,10H2,1-2H3
InChIKeyIHVBLOIBCABJAS-UHFFFAOYSA-N
XLogP1.56
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.11
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid?
The IUPAC name of [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid (CID 61481951) is [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid.
What is the SMILES notation for [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid?
The canonical SMILES for [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid is Cc1ccc(C)c(COc2ccc(B(O)O)cc2)c1.
What is the InChIKey of [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid?
The InChIKey is IHVBLOIBCABJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BO3/c1-11-3-4-12(2)13(9-11)10-19-15-7-5-14(6-8-15)16(17)18/h3-9,17-18H,10H2,1-2H3.
What are the key properties of [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid?
[4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid has a molecular weight of 256.11 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,5-dimethylphenyl)methoxy]phenyl]boronic acid is sourced from PubChem (CID 61481951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).