C20H25NO2 — CID 83953133
1-[4-[(2,5-dimethylphenyl)methoxy]phenyl]-2-(propylamino)ethanone (PubChem CID 83953133) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[4-[(2,5-dimethylphenyl)methoxy]phenyl]-2-(propylamino)ethanone.
| Compound Name | 1-[4-[(2,5-dimethylphenyl)methoxy]phenyl]-2-(propylamino)ethanone |
|---|---|
| PubChem CID | 83953133 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[4-[(2,5-dimethylphenyl)methoxy]phenyl]-2-(propylamino)ethanone |
| SMILES | CCCNCC(=O)c1ccc(OCc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C20H25NO2/c1-4-11-21-13-20(22)17-7-9-19(10-8-17)23-14-18-12-15(2)5-6-16(18)3/h5-10,12,21H,4,11,13-14H2,1-3H3 |
| InChIKey | KBHGJSHTWUYIPT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|