C8H8ClN — CID 11084082
7-chloro-2,3-dihydro-1H-indole (PubChem CID 11084082) has the molecular formula C8H8ClN and a molecular weight of 153.61 g/mol. Its IUPAC name is 7-chloro-2,3-dihydro-1H-indole.
| Compound Name | 7-chloro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 11084082 |
| Molecular Formula | C8H8ClN |
| Molecular Weight | 153.61 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 7-chloro-2,3-dihydro-1H-indole |
| SMILES | C1CNC2=C1C=CC=C2Cl |
| InChI | InChI=1S/C8H8ClN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3,10H,4-5H2 |
| InChIKey | OMPUMOUPCGQKNM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 126 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |