C22H21ClN2O2 — CID 110840891
N-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylaniline (PubChem CID 110840891) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylaniline.
| Compound Name | N-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 110840891 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4-methylaniline |
| SMILES | COc1cccc(C=NNc2ccc(C)cc2)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN2O2/c1-16-10-12-19(13-11-16)25-24-14-17-7-5-9-21(26-2)22(17)27-15-18-6-3-4-8-20(18)23/h3-14,25H,15H2,1-2H3 |
| InChIKey | HQJYMYDMXCBJNJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|