C21H18ClNO3 — CID 50885952
4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]phenol (PubChem CID 50885952) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is 4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]phenol.
| Compound Name | 4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]phenol |
|---|---|
| PubChem CID | 50885952 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]phenol |
| SMILES | COc1cccc(/C=N/c2ccc(O)cc2)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C21H18ClNO3/c1-25-20-8-4-6-15(13-23-17-9-11-18(24)12-10-17)21(20)26-14-16-5-2-3-7-19(16)22/h2-13,24H,14H2,1H3/b23-13+ |
| InChIKey | UBYDDGQKNNANHI-YDZHTSKRSA-N |
| XLogP | 5.38 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|