C21H15ClNO3- — CID 7640518
4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzoate (PubChem CID 7640518) has the molecular formula C21H15ClNO3- and a molecular weight of 364.81 g/mol. Its IUPAC name is 4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzoate.
| Compound Name | 4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 7640518 |
| Molecular Formula | C21H15ClNO3- |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4-[[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]benzoate |
| SMILES | O=C([O-])c1ccc(/N=C/c2ccccc2OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H16ClNO3/c22-19-7-3-1-6-17(19)14-26-20-8-4-2-5-16(20)13-23-18-11-9-15(10-12-18)21(24)25/h1-13H,14H2,(H,24,25)/p-1/b23-13+ |
| InChIKey | UJCVJGROCYZDEH-YDZHTSKRSA-M |
| XLogP | 4.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|