C23H22Cl2N2O2 — CID 5032689
4-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N,N-dimethylaniline (PubChem CID 5032689) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 4-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 5032689 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N,N-dimethylaniline |
| SMILES | COc1cccc(/C=N/c2ccc(N(C)C)cc2)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O2/c1-27(2)20-11-9-19(10-12-20)26-14-16-5-4-6-22(28-3)23(16)29-15-17-7-8-18(24)13-21(17)25/h4-14H,15H2,1-3H3/b26-14+ |
| InChIKey | WJFSQIFQKBKHBG-VULFUBBASA-N |
| XLogP | 6.40 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|