C25H38N2O5 — CID 110846867
methyl 4-(3-methoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110846867) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is methyl 4-(3-methoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(3-methoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110846867 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | methyl 4-(3-methoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCCOc1ccc(C2NC(=O)NC(CCC)=C2C(=O)OC)cc1OC |
| InChI | InChI=1S/C25H38N2O5/c1-5-7-8-9-10-11-12-16-32-20-15-14-18(17-21(20)30-3)23-22(24(28)31-4)19(13-6-2)26-25(29)27-23/h14-15,17,23H,5-13,16H2,1-4H3,(H2,26,27,29) |
| InChIKey | NHHWREGMAKJKDL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|