C28H44N2O5 — CID 110847329
propan-2-yl 4-(3-ethoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110847329) has the molecular formula C28H44N2O5 and a molecular weight of 488.67 g/mol. Its IUPAC name is propan-2-yl 4-(3-ethoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 4-(3-ethoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110847329 |
| Molecular Formula | C28H44N2O5 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | propan-2-yl 4-(3-ethoxy-4-nonoxyphenyl)-2-oxo-6-propyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCCOc1ccc(C2NC(=O)NC(CCC)=C2C(=O)OC(C)C)cc1OCC |
| InChI | InChI=1S/C28H44N2O5/c1-6-9-10-11-12-13-14-18-34-23-17-16-21(19-24(23)33-8-3)26-25(27(31)35-20(4)5)22(15-7-2)29-28(32)30-26/h16-17,19-20,26H,6-15,18H2,1-5H3,(H2,29,30,32) |
| InChIKey | SKFCUDPJMUXLNR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|