C12H15ClN2O2 — CID 110848953
5-chloro-N-cyclohexyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 110848953) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-chloro-N-cyclohexyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-cyclohexyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110848953 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-chloro-N-cyclohexyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C12H15ClN2O2/c13-8-6-10(11(16)14-7-8)12(17)15-9-4-2-1-3-5-9/h6-7,9H,1-5H2,(H,14,16)(H,15,17) |
| InChIKey | XRTDPIIJFXEKMA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |