C9H13N3O2 — CID 110849739
(4-methylpiperazin-1-yl)-(1,2-oxazol-4-yl)methanone (PubChem CID 110849739) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(1,2-oxazol-4-yl)methanone.
| Compound Name | (4-methylpiperazin-1-yl)-(1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 110849739 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(1,2-oxazol-4-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cnoc2)CC1 |
| InChI | InChI=1S/C9H13N3O2/c1-11-2-4-12(5-3-11)9(13)8-6-10-14-7-8/h6-7H,2-5H2,1H3 |
| InChIKey | NDBFGIFXPXGYJJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |