C16H23Cl2N3O3 — CID 167323293
[4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1,2-oxazol-4-yl)methanone (PubChem CID 167323293) has the molecular formula C16H23Cl2N3O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1,2-oxazol-4-yl)methanone.
| Compound Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 167323293 |
| Molecular Formula | C16H23Cl2N3O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [4-[(R)-amino-(4,5-dichloro-2-hydroxycyclohexyl)methyl]piperidin-1-yl]-(1,2-oxazol-4-yl)methanone |
| SMILES | N[C@H](C1CCN(C(=O)c2cnoc2)CC1)C1CC(Cl)C(Cl)CC1O |
| InChI | InChI=1S/C16H23Cl2N3O3/c17-12-5-11(14(22)6-13(12)18)15(19)9-1-3-21(4-2-9)16(23)10-7-20-24-8-10/h7-9,11-15,22H,1-6,19H2/t11?,12?,13?,14?,15-/m1/s1 |
| InChIKey | IJEWXSNHHBDDRM-ZPWMNFGTSA-N |
| XLogP | 1.84 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|