C16H16N2O2 — CID 110850455
N-(furan-2-ylmethyl)-1,6-dimethylindole-2-carboxamide (PubChem CID 110850455) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,6-dimethylindole-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1,6-dimethylindole-2-carboxamide |
|---|---|
| PubChem CID | 110850455 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,6-dimethylindole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCc3ccco3)n(C)c2c1 |
| InChI | InChI=1S/C16H16N2O2/c1-11-5-6-12-9-15(18(2)14(12)8-11)16(19)17-10-13-4-3-7-20-13/h3-9H,10H2,1-2H3,(H,17,19) |
| InChIKey | ZSCCKDVIQXDPBB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |