C12H10ClN3O2 — CID 110851434
N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 110851434) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110851434 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1cnc[nH]c1=O |
| InChI | InChI=1S/C12H10ClN3O2/c13-10-4-2-1-3-8(10)5-15-11(17)9-6-14-7-16-12(9)18/h1-4,6-7H,5H2,(H,15,17)(H,14,16,18) |
| InChIKey | VPTUQFNXCXUKNO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |