C13H13N3O4 — CID 110851663
N-[(4-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 110851663) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110851663 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H13N3O4/c1-20-9-4-2-8(3-5-9)6-14-11(17)10-7-15-13(19)16-12(10)18/h2-5,7H,6H2,1H3,(H,14,17)(H2,15,16,18,19) |
| InChIKey | LRLDNLRQIRZRIR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |