C10H16N2OS — CID 110855689
N-butyl-N,2-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 110855689) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-butyl-N,2-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-butyl-N,2-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110855689 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-butyl-N,2-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C10H16N2OS/c1-4-5-6-12(3)10(13)9-7-11-8(2)14-9/h7H,4-6H2,1-3H3 |
| InChIKey | DIVCMUZKFZIZNL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |