C11H17N3O2 — CID 110855764
N-butyl-N,2-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 110855764) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-butyl-N,2-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-butyl-N,2-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110855764 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-butyl-N,2-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnc(C)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O2/c1-4-5-6-14(3)11(16)9-7-12-8(2)13-10(9)15/h7H,4-6H2,1-3H3,(H,12,13,15) |
| InChIKey | WMYMBBBABUBMGU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |