C20H20N4O — CID 110855826
(4-benzylpiperidin-1-yl)-pyrido[2,3-b]pyrazin-7-ylmethanone (PubChem CID 110855826) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-pyrido[2,3-b]pyrazin-7-ylmethanone.
| Compound Name | (4-benzylpiperidin-1-yl)-pyrido[2,3-b]pyrazin-7-ylmethanone |
|---|---|
| PubChem CID | 110855826 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-pyrido[2,3-b]pyrazin-7-ylmethanone |
| SMILES | O=C(c1cnc2nccnc2c1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N4O/c25-20(17-13-18-19(23-14-17)22-9-8-21-18)24-10-6-16(7-11-24)12-15-4-2-1-3-5-15/h1-5,8-9,13-14,16H,6-7,10-12H2 |
| InChIKey | RECGHZBDUZSRQS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |