C27H30N4O — CID 50847507
(4-benzylpiperidin-1-yl)-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone (PubChem CID 50847507) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 50847507 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[4-(3-pyrrolidin-1-ylpyrazin-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2nccnc2N2CCCC2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N4O/c32-27(31-18-12-22(13-19-31)20-21-6-2-1-3-7-21)24-10-8-23(9-11-24)25-26(29-15-14-28-25)30-16-4-5-17-30/h1-3,6-11,14-15,22H,4-5,12-13,16-20H2 |
| InChIKey | ZPPFERZIBIITPG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |