C16H20N2OS — CID 110858372
N-(2-tert-butylphenyl)-2,5-dimethyl-1,3-thiazole-4-carboxamide (PubChem CID 110858372) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2,5-dimethyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-2,5-dimethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110858372 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-(2-tert-butylphenyl)-2,5-dimethyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccccc2C(C)(C)C)c(C)s1 |
| InChI | InChI=1S/C16H20N2OS/c1-10-14(17-11(2)20-10)15(19)18-13-9-7-6-8-12(13)16(3,4)5/h6-9H,1-5H3,(H,18,19) |
| InChIKey | QJEXDIIVZBNTSO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |