C14H15ClN2OS — CID 110859463
N-(2-chloro-4,6-dimethylphenyl)-3-(1,3-thiazol-4-yl)propanamide (PubChem CID 110859463) has the molecular formula C14H15ClN2OS and a molecular weight of 294.81 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-(1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-(1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110859463 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-(1,3-thiazol-4-yl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCc2cscn2)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2OS/c1-9-5-10(2)14(12(15)6-9)17-13(18)4-3-11-7-19-8-16-11/h5-8H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | BXYBSNGEAHOLDD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |