C13H22O2S — CID 11085961
methyl (E,3E)-3-(ethylsulfanylmethylidene)non-4-enoate (PubChem CID 11085961) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is methyl (E,3E)-3-(ethylsulfanylmethylidene)non-4-enoate.
| Compound Name | methyl (E,3E)-3-(ethylsulfanylmethylidene)non-4-enoate |
|---|---|
| PubChem CID | 11085961 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl (E,3E)-3-(ethylsulfanylmethylidene)non-4-enoate |
| SMILES | CCCC/C=C/C(=C/SCC)CC(=O)OC |
| InChI | InChI=1S/C13H22O2S/c1-4-6-7-8-9-12(11-16-5-2)10-13(14)15-3/h8-9,11H,4-7,10H2,1-3H3/b9-8+,12-11- |
| InChIKey | CHGVIXHAJKHVFR-UPDVNHGHSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|