C15H20N2O — CID 11086018
(3S,8aR)-3-methyl-1-(4-methylphenyl)-3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-2-one (PubChem CID 11086018) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (3S,8aR)-3-methyl-1-(4-methylphenyl)-3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-2-one.
| Compound Name | (3S,8aR)-3-methyl-1-(4-methylphenyl)-3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-2-one |
|---|---|
| PubChem CID | 11086018 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (3S,8aR)-3-methyl-1-(4-methylphenyl)-3,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-2-one |
| SMILES | Cc1ccc(N2C(=O)[C@H](C)N3CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-11-6-8-13(9-7-11)17-14-5-3-4-10-16(14)12(2)15(17)18/h6-9,12,14H,3-5,10H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | KMWJRYIDAWXTLL-GXTWGEPZSA-N |
| XLogP | 2.54 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |