C14H13ClN2O4 — CID 110860623
5-chloro-N-(2,4-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 110860623) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(2,4-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110860623 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 5-chloro-N-(2,4-dimethoxyphenyl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c[nH]c(=O)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-20-9-3-4-11(12(6-9)21-2)17-13(18)8-5-10(15)14(19)16-7-8/h3-7H,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | XCLFNCHGAQRSFS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |