C16H16N4OS — CID 110862125
N-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 110862125) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 110862125 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1cn2ccsc2n1 |
| InChI | InChI=1S/C16H16N4OS/c21-15(14-11-20-9-10-22-16(20)18-14)17-12-3-5-13(6-4-12)19-7-1-2-8-19/h3-6,9-11H,1-2,7-8H2,(H,17,21) |
| InChIKey | SXVUUOYNNOXFRR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|