C14H17NO3S — CID 110863351
N-(2,3-dihydro-1,4-benzodioxin-6-yl)thiane-2-carboxamide (PubChem CID 110863351) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)thiane-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 110863351 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)thiane-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C1CCCCS1 |
| InChI | InChI=1S/C14H17NO3S/c16-14(13-3-1-2-8-19-13)15-10-4-5-11-12(9-10)18-7-6-17-11/h4-5,9,13H,1-3,6-8H2,(H,15,16) |
| InChIKey | FFUUXIVIQKMNQF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |