C18H15N3O — CID 110864766
N-(3-cyanophenyl)-2,4-dimethyl-1H-indole-3-carboxamide (PubChem CID 110864766) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2,4-dimethyl-1H-indole-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-2,4-dimethyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 110864766 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-(3-cyanophenyl)-2,4-dimethyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2cccc(C)c2c1C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H15N3O/c1-11-5-3-8-15-16(11)17(12(2)20-15)18(22)21-14-7-4-6-13(9-14)10-19/h3-9,20H,1-2H3,(H,21,22) |
| InChIKey | XDHSNRAIPAYAPP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |