C14H12N4O2 — CID 136669999
N-(3-cyanophenyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136669999) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(3-cyanophenyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136669999 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(3-cyanophenyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2cccc(C#N)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H12N4O2/c1-8-12(13(19)17-9(2)16-8)14(20)18-11-5-3-4-10(6-11)7-15/h3-6H,1-2H3,(H,18,20)(H,16,17,19) |
| InChIKey | SIMQXESYSHRLNU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |