C19H14N4O2 — CID 110332204
N-(3-cyanophenyl)-4-(4-methylphenyl)-2-oxo-1H-pyrimidine-6-carboxamide (PubChem CID 110332204) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-(4-methylphenyl)-2-oxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(3-cyanophenyl)-4-(4-methylphenyl)-2-oxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110332204 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-(3-cyanophenyl)-4-(4-methylphenyl)-2-oxo-1H-pyrimidine-6-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3cccc(C#N)c3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C19H14N4O2/c1-12-5-7-14(8-6-12)16-10-17(23-19(25)22-16)18(24)21-15-4-2-3-13(9-15)11-20/h2-10H,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | NDQWAGGVGTWOIJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |